C8H13NO4 — CID 146629692
trans-(1S,2S)-1-methyl-2-(nitromethyl)cyclopentane-1-carboxylic acid (PubChem CID 146629692) has the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. Its IUPAC name is trans-(1S,2S)-1-methyl-2-(nitromethyl)cyclopentane-1-carboxylic acid.
| Compound Name | trans-(1S,2S)-1-methyl-2-(nitromethyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 146629692 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | trans-(1S,2S)-1-methyl-2-(nitromethyl)cyclopentane-1-carboxylic acid |
| SMILES | C[C@]1(C(=O)O)CCC[C@@H]1C[N+](=O)[O-] |
| InChI | InChI=1S/C8H13NO4/c1-8(7(10)11)4-2-3-6(8)5-9(12)13/h6H,2-5H2,1H3,(H,10,11)/t6-,8+/m1/s1 |
| InChIKey | KCPDKXQYIOQVBA-SVRRBLITSA-N |
| XLogP | 1.15 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|