C10H17NO3 — CID 102478015
cis-(1R,2R)-2-(nitromethyl)-1-propan-2-ylcyclopentane-1-carbaldehyde (PubChem CID 102478015) has the molecular formula C10H17NO3 and a molecular weight of 199.25 g/mol. Its IUPAC name is cis-(1R,2R)-2-(nitromethyl)-1-propan-2-ylcyclopentane-1-carbaldehyde.
| Compound Name | cis-(1R,2R)-2-(nitromethyl)-1-propan-2-ylcyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 102478015 |
| Molecular Formula | C10H17NO3 |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.12 |
| IUPAC Name | cis-(1R,2R)-2-(nitromethyl)-1-propan-2-ylcyclopentane-1-carbaldehyde |
| SMILES | CC(C)[C@]1(C=O)CCC[C@H]1C[N+](=O)[O-] |
| InChI | InChI=1S/C10H17NO3/c1-8(2)10(7-12)5-3-4-9(10)6-11(13)14/h7-9H,3-6H2,1-2H3/t9-,10+/m0/s1 |
| InChIKey | IPMJCGUZKAXWQT-VHSXEESVSA-N |
| XLogP | 1.90 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|