C12H20O4 — CID 150353209
1-methyl-2-propan-2-ylcyclohexane-1,3-dicarboxylic acid (PubChem CID 150353209) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-methyl-2-propan-2-ylcyclohexane-1,3-dicarboxylic acid.
| Compound Name | 1-methyl-2-propan-2-ylcyclohexane-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 150353209 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 1-methyl-2-propan-2-ylcyclohexane-1,3-dicarboxylic acid |
| SMILES | CC(C)C1C(C(=O)O)CCCC1(C)C(=O)O |
| InChI | InChI=1S/C12H20O4/c1-7(2)9-8(10(13)14)5-4-6-12(9,3)11(15)16/h7-9H,4-6H2,1-3H3,(H,13,14)(H,15,16) |
| InChIKey | GUEDSBHLXSJPES-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |