1-methyl-2-propan-2-ylcyclohexane-1,3-dicarboxylic acid

C12H20O4 — CID 150353209

IUPAC1-methyl-2-propan-2-ylcyclohexane-1,3-dicarboxylic acid
SMILESCC(C)C1C(C(=O)O)CCCC1(C)C(=O)O
InChIInChI=1S/C12H20O4/c1-7(2)9-8(10(13)14)5-4-6-12(9,3)11(15)16/h7-9H,4-6H2,1-3H3,(H,13,14)(H,15,16)
InChIKeyGUEDSBHLXSJPES-UHFFFAOYSA-N
MW228.29 g/mol
LogP2.23
Rot. Bonds3

About 1-methyl-2-propan-2-ylcyclohexane-1,3-dicarboxylic acid

1-methyl-2-propan-2-ylcyclohexane-1,3-dicarboxylic acid (PubChem CID 150353209) has the molecular formula C12H20O4 and a molecular weight of 228.29 g/mol. Its IUPAC name is 1-methyl-2-propan-2-ylcyclohexane-1,3-dicarboxylic acid.

Molecular Properties

Compound Name1-methyl-2-propan-2-ylcyclohexane-1,3-dicarboxylic acid
PubChem CID150353209
Molecular FormulaC12H20O4
Molecular Weight228.29 g/mol
Exact Mass228.14
IUPAC Name1-methyl-2-propan-2-ylcyclohexane-1,3-dicarboxylic acid
SMILESCC(C)C1C(C(=O)O)CCCC1(C)C(=O)O
InChIInChI=1S/C12H20O4/c1-7(2)9-8(10(13)14)5-4-6-12(9,3)11(15)16/h7-9H,4-6H2,1-3H3,(H,13,14)(H,15,16)
InChIKeyGUEDSBHLXSJPES-UHFFFAOYSA-N
XLogP2.23
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.29
LogP ≤ 52.23
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 1-methyl-2-propan-2-ylcyclohexane-1,3-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methyl-2-propan-2-ylcyclohexane-1,3-dicarboxylic acid?
The IUPAC name of 1-methyl-2-propan-2-ylcyclohexane-1,3-dicarboxylic acid (CID 150353209) is 1-methyl-2-propan-2-ylcyclohexane-1,3-dicarboxylic acid.
What is the SMILES notation for 1-methyl-2-propan-2-ylcyclohexane-1,3-dicarboxylic acid?
The canonical SMILES for 1-methyl-2-propan-2-ylcyclohexane-1,3-dicarboxylic acid is CC(C)C1C(C(=O)O)CCCC1(C)C(=O)O.
What is the InChIKey of 1-methyl-2-propan-2-ylcyclohexane-1,3-dicarboxylic acid?
The InChIKey is GUEDSBHLXSJPES-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20O4/c1-7(2)9-8(10(13)14)5-4-6-12(9,3)11(15)16/h7-9H,4-6H2,1-3H3,(H,13,14)(H,15,16).
What are the key properties of 1-methyl-2-propan-2-ylcyclohexane-1,3-dicarboxylic acid?
1-methyl-2-propan-2-ylcyclohexane-1,3-dicarboxylic acid has a molecular weight of 228.29 g/mol, XLogP of 2.23, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2-propan-2-ylcyclohexane-1,3-dicarboxylic acid is sourced from PubChem (CID 150353209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).