About 1-[(1S,2R)-2-hydroxy-1-methylcyclopentyl]propan-1-one
1-[(1S,2R)-2-hydroxy-1-methylcyclopentyl]propan-1-one (PubChem CID 11686947) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 1-[(1S,2R)-2-hydroxy-1-methylcyclopentyl]propan-1-one.
Analyze 1-[(1S,2R)-2-hydroxy-1-methylcyclopentyl]propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(1S,2R)-2-hydroxy-1-methylcyclopentyl]propan-1-one?
The IUPAC name of 1-[(1S,2R)-2-hydroxy-1-methylcyclopentyl]propan-1-one (CID 11686947) is 1-[(1S,2R)-2-hydroxy-1-methylcyclopentyl]propan-1-one.
What is the SMILES notation for 1-[(1S,2R)-2-hydroxy-1-methylcyclopentyl]propan-1-one?
The canonical SMILES for 1-[(1S,2R)-2-hydroxy-1-methylcyclopentyl]propan-1-one is CCC(=O)[C@@]1(C)CCC[C@H]1O.
What is the InChIKey of 1-[(1S,2R)-2-hydroxy-1-methylcyclopentyl]propan-1-one?
The InChIKey is BTCPLZGTQLNQJX-RKDXNWHRSA-N. The full InChI is InChI=1S/C9H16O2/c1-3-7(10)9(2)6-4-5-8(9)11/h8,11H,3-6H2,1-2H3/t8-,9-/m1/s1.
What are the key properties of 1-[(1S,2R)-2-hydroxy-1-methylcyclopentyl]propan-1-one?
1-[(1S,2R)-2-hydroxy-1-methylcyclopentyl]propan-1-one has a molecular weight of 156.22 g/mol, XLogP of 1.52, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(1S,2R)-2-hydroxy-1-methylcyclopentyl]propan-1-one is sourced from PubChem (CID 11686947), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).