C17H30O — CID 174549331
1-(2,3,8,8-tetramethyl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-yl)propan-1-one (PubChem CID 174549331) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is 1-(2,3,8,8-tetramethyl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-yl)propan-1-one.
| Compound Name | 1-(2,3,8,8-tetramethyl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-yl)propan-1-one |
|---|---|
| PubChem CID | 174549331 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | 1-(2,3,8,8-tetramethyl-1,3,4,4a,5,6,7,8a-octahydronaphthalen-2-yl)propan-1-one |
| SMILES | CCC(=O)C1(C)CC2C(CCCC2(C)C)CC1C |
| InChI | InChI=1S/C17H30O/c1-6-15(18)17(5)11-14-13(10-12(17)2)8-7-9-16(14,3)4/h12-14H,6-11H2,1-5H3 |
| InChIKey | DGOXQINIYHFDKT-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |