C15H28O — CID 176561000
(4aS,7S)-7-ethoxy-4,4,7-trimethyl-1,2,3,4a,5,6,8,8a-octahydronaphthalene (PubChem CID 176561000) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is (4aS,7S)-7-ethoxy-4,4,7-trimethyl-1,2,3,4a,5,6,8,8a-octahydronaphthalene.
| Compound Name | (4aS,7S)-7-ethoxy-4,4,7-trimethyl-1,2,3,4a,5,6,8,8a-octahydronaphthalene |
|---|---|
| PubChem CID | 176561000 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | (4aS,7S)-7-ethoxy-4,4,7-trimethyl-1,2,3,4a,5,6,8,8a-octahydronaphthalene |
| SMILES | CCO[C@@]1(C)CC[C@H]2C(CCCC2(C)C)C1 |
| InChI | InChI=1S/C15H28O/c1-5-16-15(4)10-8-13-12(11-15)7-6-9-14(13,2)3/h12-13H,5-11H2,1-4H3/t12?,13-,15-/m0/s1 |
| InChIKey | XHKXANLRPDYIIC-MHEXWIEDSA-N |
| XLogP | 4.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |