About 3-methyl-1,1-dinitrocyclopentane
3-methyl-1,1-dinitrocyclopentane (PubChem CID 88539382) has the molecular formula C6H10N2O4
and a molecular weight of 174.16 g/mol. Its IUPAC name is 3-methyl-1,1-dinitrocyclopentane.
Molecular Properties
| Compound Name | 3-methyl-1,1-dinitrocyclopentane |
| PubChem CID | 88539382 |
| Molecular Formula | C6H10N2O4 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | 3-methyl-1,1-dinitrocyclopentane |
| SMILES | CC1CCC([N+](=O)[O-])([N+](=O)[O-])C1 |
| InChI | InChI=1S/C6H10N2O4/c1-5-2-3-6(4-5,7(9)10)8(11)12/h5H,2-4H2,1H3 |
| InChIKey | QAUXTLPAUSBEIQ-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-methyl-1,1-dinitrocyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1,1-dinitrocyclopentane?
The IUPAC name of 3-methyl-1,1-dinitrocyclopentane (CID 88539382) is 3-methyl-1,1-dinitrocyclopentane.
What is the SMILES notation for 3-methyl-1,1-dinitrocyclopentane?
The canonical SMILES for 3-methyl-1,1-dinitrocyclopentane is CC1CCC([N+](=O)[O-])([N+](=O)[O-])C1.
What is the InChIKey of 3-methyl-1,1-dinitrocyclopentane?
The InChIKey is QAUXTLPAUSBEIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2O4/c1-5-2-3-6(4-5,7(9)10)8(11)12/h5H,2-4H2,1H3.
What are the key properties of 3-methyl-1,1-dinitrocyclopentane?
3-methyl-1,1-dinitrocyclopentane has a molecular weight of 174.16 g/mol, XLogP of 1.06, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1,1-dinitrocyclopentane is sourced from PubChem (CID 88539382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).