C11H17NO4 — CID 53392224
(1R,6R,7S,8R)-7-hydroxy-8-methyl-1-nitrobicyclo[4.3.1]decan-10-one (PubChem CID 53392224) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is (1R,6R,7S,8R)-7-hydroxy-8-methyl-1-nitrobicyclo[4.3.1]decan-10-one.
| Compound Name | (1R,6R,7S,8R)-7-hydroxy-8-methyl-1-nitrobicyclo[4.3.1]decan-10-one |
|---|---|
| PubChem CID | 53392224 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | (1R,6R,7S,8R)-7-hydroxy-8-methyl-1-nitrobicyclo[4.3.1]decan-10-one |
| SMILES | C[C@@H]1C[C@]2([N+](=O)[O-])CCCC[C@@H](C2=O)[C@H]1O |
| InChI | InChI=1S/C11H17NO4/c1-7-6-11(12(15)16)5-3-2-4-8(9(7)13)10(11)14/h7-9,13H,2-6H2,1H3/t7-,8-,9+,11-/m1/s1 |
| InChIKey | AHRCAZYTLXCHPO-SDNRWEOFSA-N |
| XLogP | 1.16 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|