C14H23NO4 — CID 53392305
(1R,9S,10S,12S)-10-hydroxy-12-methyl-1-nitrobicyclo[7.3.1]tridecan-13-one (PubChem CID 53392305) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is (1R,9S,10S,12S)-10-hydroxy-12-methyl-1-nitrobicyclo[7.3.1]tridecan-13-one.
| Compound Name | (1R,9S,10S,12S)-10-hydroxy-12-methyl-1-nitrobicyclo[7.3.1]tridecan-13-one |
|---|---|
| PubChem CID | 53392305 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | (1R,9S,10S,12S)-10-hydroxy-12-methyl-1-nitrobicyclo[7.3.1]tridecan-13-one |
| SMILES | C[C@H]1C[C@H](O)[C@@H]2CCCCCCC[C@]1([N+](=O)[O-])C2=O |
| InChI | InChI=1S/C14H23NO4/c1-10-9-12(16)11-7-5-3-2-4-6-8-14(10,13(11)17)15(18)19/h10-12,16H,2-9H2,1H3/t10-,11-,12-,14+/m0/s1 |
| InChIKey | UOHQZBRRYARCCS-ZJQBRPOHSA-N |
| XLogP | 2.33 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|