C9H13NO4 — CID 53392220
(1R,4R,5R)-4-hydroxy-1-nitrobicyclo[3.3.1]nonan-9-one (PubChem CID 53392220) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is (1R,4R,5R)-4-hydroxy-1-nitrobicyclo[3.3.1]nonan-9-one.
| Compound Name | (1R,4R,5R)-4-hydroxy-1-nitrobicyclo[3.3.1]nonan-9-one |
|---|---|
| PubChem CID | 53392220 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | (1R,4R,5R)-4-hydroxy-1-nitrobicyclo[3.3.1]nonan-9-one |
| SMILES | O=C1[C@@H]2CCC[C@@]1([N+](=O)[O-])CC[C@H]2O |
| InChI | InChI=1S/C9H13NO4/c11-7-3-5-9(10(13)14)4-1-2-6(7)8(9)12/h6-7,11H,1-5H2/t6-,7-,9-/m1/s1 |
| InChIKey | VWNLTNAYDSRDTN-ZXFLCMHBSA-N |
| XLogP | 0.53 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|