C15H17NO3 — CID 134859568
4-hydroxy-8-oxo-N-phenylbicyclo[3.2.1]octane-1-carboxamide (PubChem CID 134859568) has the molecular formula C15H17NO3 and a molecular weight of 259.30 g/mol. Its IUPAC name is 4-hydroxy-8-oxo-N-phenylbicyclo[3.2.1]octane-1-carboxamide.
| Compound Name | 4-hydroxy-8-oxo-N-phenylbicyclo[3.2.1]octane-1-carboxamide |
|---|---|
| PubChem CID | 134859568 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 4-hydroxy-8-oxo-N-phenylbicyclo[3.2.1]octane-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)C12CCC(O)C(CC1)C2=O |
| InChI | InChI=1S/C15H17NO3/c17-12-7-9-15(8-6-11(12)13(15)18)14(19)16-10-4-2-1-3-5-10/h1-5,11-12,17H,6-9H2,(H,16,19) |
| InChIKey | MIMABVZLWBXSRH-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|