C14H16BrNO — CID 98514180
(1S,2S,4S)-2-bromo-N-phenylbicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 98514180) has the molecular formula C14H16BrNO and a molecular weight of 294.19 g/mol. Its IUPAC name is (1S,2S,4S)-2-bromo-N-phenylbicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1S,2S,4S)-2-bromo-N-phenylbicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 98514180 |
| Molecular Formula | C14H16BrNO |
| Molecular Weight | 294.19 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | (1S,2S,4S)-2-bromo-N-phenylbicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)[C@@]12CC[C@H](C[C@@H]1Br)C2 |
| InChI | InChI=1S/C14H16BrNO/c15-12-8-10-6-7-14(12,9-10)13(17)16-11-4-2-1-3-5-11/h1-5,10,12H,6-9H2,(H,16,17)/t10-,12+,14-/m1/s1 |
| InChIKey | UHKKOCUTBATJDQ-SCDSUCTJSA-N |
| XLogP | 3.58 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|