C14H14N2O5 — CID 53360399
(1S,9S)-5,9-dinitrotricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-14-one (PubChem CID 53360399) has the molecular formula C14H14N2O5 and a molecular weight of 290.27 g/mol. Its IUPAC name is (1S,9S)-5,9-dinitrotricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-14-one.
| Compound Name | (1S,9S)-5,9-dinitrotricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-14-one |
|---|---|
| PubChem CID | 53360399 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.27 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | (1S,9S)-5,9-dinitrotricyclo[7.4.1.02,7]tetradeca-2(7),3,5-trien-14-one |
| SMILES | O=C1[C@H]2CCCC[C@]1([N+](=O)[O-])Cc1cc([N+](=O)[O-])ccc12 |
| InChI | InChI=1S/C14H14N2O5/c17-13-12-3-1-2-6-14(13,16(20)21)8-9-7-10(15(18)19)4-5-11(9)12/h4-5,7,12H,1-3,6,8H2/t12-,14-/m0/s1 |
| InChIKey | VEQQVHNVIFJPSX-JSGCOSHPSA-N |
| XLogP | 2.39 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.27 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|