C11H11NO2S — CID 91132080
4-nitro-12-thiatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene (PubChem CID 91132080) has the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. Its IUPAC name is 4-nitro-12-thiatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene.
| Compound Name | 4-nitro-12-thiatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene |
|---|---|
| PubChem CID | 91132080 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | 4-nitro-12-thiatricyclo[6.3.1.02,7]dodeca-2(7),3,5-triene |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C1CCCC2S1 |
| InChI | InChI=1S/C11H11NO2S/c13-12(14)7-4-5-8-9(6-7)11-3-1-2-10(8)15-11/h4-6,10-11H,1-3H2 |
| InChIKey | NYUSDQHQOQUAOJ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|