C12H12N2O2S — CID 22462447
7-nitro-1,2,3,3a,5,9b-hexahydrocyclopenta[c]quinoline-4-thione (PubChem CID 22462447) has the molecular formula C12H12N2O2S and a molecular weight of 248.31 g/mol. Its IUPAC name is 7-nitro-1,2,3,3a,5,9b-hexahydrocyclopenta[c]quinoline-4-thione.
| Compound Name | 7-nitro-1,2,3,3a,5,9b-hexahydrocyclopenta[c]quinoline-4-thione |
|---|---|
| PubChem CID | 22462447 |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.31 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 7-nitro-1,2,3,3a,5,9b-hexahydrocyclopenta[c]quinoline-4-thione |
| SMILES | O=[N+]([O-])c1ccc2c(c1)NC(=S)C1CCCC21 |
| InChI | InChI=1S/C12H12N2O2S/c15-14(16)7-4-5-9-8-2-1-3-10(8)12(17)13-11(9)6-7/h4-6,8,10H,1-3H2,(H,13,17) |
| InChIKey | UMMDCDPDZFLOAR-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|