C10H10N2O3S — CID 22623059
2-ethyl-7-nitro-4H-1,4-benzoxazine-3-thione (PubChem CID 22623059) has the molecular formula C10H10N2O3S and a molecular weight of 238.27 g/mol. Its IUPAC name is 2-ethyl-7-nitro-4H-1,4-benzoxazine-3-thione.
| Compound Name | 2-ethyl-7-nitro-4H-1,4-benzoxazine-3-thione |
|---|---|
| PubChem CID | 22623059 |
| Molecular Formula | C10H10N2O3S |
| Molecular Weight | 238.27 g/mol |
| Exact Mass | 238.04 |
| IUPAC Name | 2-ethyl-7-nitro-4H-1,4-benzoxazine-3-thione |
| SMILES | CCC1Oc2cc([N+](=O)[O-])ccc2NC1=S |
| InChI | InChI=1S/C10H10N2O3S/c1-2-8-10(16)11-7-4-3-6(12(13)14)5-9(7)15-8/h3-5,8H,2H2,1H3,(H,11,16) |
| InChIKey | VLGIMPZKLVMJCZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.27 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|