C22H27N4O4+ — CID 7084934
(2R)-2-[2-[4-(2,6-dimethylphenyl)piperazin-1-ium-1-yl]ethyl]-7-nitro-4H-1,4-benzoxazin-3-one (PubChem CID 7084934) has the molecular formula C22H27N4O4+ and a molecular weight of 411.48 g/mol. Its IUPAC name is (2R)-2-[2-[4-(2,6-dimethylphenyl)piperazin-1-ium-1-yl]ethyl]-7-nitro-4H-1,4-benzoxazin-3-one.
| Compound Name | (2R)-2-[2-[4-(2,6-dimethylphenyl)piperazin-1-ium-1-yl]ethyl]-7-nitro-4H-1,4-benzoxazin-3-one |
|---|---|
| PubChem CID | 7084934 |
| Molecular Formula | C22H27N4O4+ |
| Molecular Weight | 411.48 g/mol |
| Exact Mass | 411.20 |
| IUPAC Name | (2R)-2-[2-[4-(2,6-dimethylphenyl)piperazin-1-ium-1-yl]ethyl]-7-nitro-4H-1,4-benzoxazin-3-one |
| SMILES | Cc1cccc(C)c1N1CC[NH+](CC[C@H]2Oc3cc([N+](=O)[O-])ccc3NC2=O)CC1 |
| InChI | InChI=1S/C22H26N4O4/c1-15-4-3-5-16(2)21(15)25-12-10-24(11-13-25)9-8-19-22(27)23-18-7-6-17(26(28)29)14-20(18)30-19/h3-7,14,19H,8-13H2,1-2H3,(H,23,27)/p+1/t19-/m1/s1 |
| InChIKey | OKCKWRUPHWZSTL-LJQANCHMSA-O |
| XLogP | 1.71 |
| TPSA | 89.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.48 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|