C14H16N2O3 — CID 100816915
(5aR,10aS)-3-nitro-5,5a,6,7,8,9,10,10a-octahydrocyclohepta[b]quinolin-11-one (PubChem CID 100816915) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is (5aR,10aS)-3-nitro-5,5a,6,7,8,9,10,10a-octahydrocyclohepta[b]quinolin-11-one.
| Compound Name | (5aR,10aS)-3-nitro-5,5a,6,7,8,9,10,10a-octahydrocyclohepta[b]quinolin-11-one |
|---|---|
| PubChem CID | 100816915 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (5aR,10aS)-3-nitro-5,5a,6,7,8,9,10,10a-octahydrocyclohepta[b]quinolin-11-one |
| SMILES | O=C1c2ccc([N+](=O)[O-])cc2N[C@@H]2CCCCC[C@H]12 |
| InChI | InChI=1S/C14H16N2O3/c17-14-10-4-2-1-3-5-12(10)15-13-8-9(16(18)19)6-7-11(13)14/h6-8,10,12,15H,1-5H2/t10-,12+/m0/s1 |
| InChIKey | PWENJZSMQGTTKI-CMPLNLGQSA-N |
| XLogP | 3.15 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|