C11H12N2O2 — CID 70828062
2-cyclopropyl-5-nitro-2,3-dihydro-1H-indole (PubChem CID 70828062) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 2-cyclopropyl-5-nitro-2,3-dihydro-1H-indole.
| Compound Name | 2-cyclopropyl-5-nitro-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 70828062 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 2-cyclopropyl-5-nitro-2,3-dihydro-1H-indole |
| SMILES | O=[N+]([O-])c1ccc2c(c1)CC(C1CC1)N2 |
| InChI | InChI=1S/C11H12N2O2/c14-13(15)9-3-4-10-8(5-9)6-11(12-10)7-1-2-7/h3-5,7,11-12H,1-2,6H2 |
| InChIKey | JFQVZNLAXDNLIH-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|