C11H14N2O3 — CID 70828178
2-(5-nitro-2,3-dihydro-1H-indol-2-yl)propan-1-ol (PubChem CID 70828178) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is 2-(5-nitro-2,3-dihydro-1H-indol-2-yl)propan-1-ol.
| Compound Name | 2-(5-nitro-2,3-dihydro-1H-indol-2-yl)propan-1-ol |
|---|---|
| PubChem CID | 70828178 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 2-(5-nitro-2,3-dihydro-1H-indol-2-yl)propan-1-ol |
| SMILES | CC(CO)C1Cc2cc([N+](=O)[O-])ccc2N1 |
| InChI | InChI=1S/C11H14N2O3/c1-7(6-14)11-5-8-4-9(13(15)16)2-3-10(8)12-11/h2-4,7,11-12,14H,5-6H2,1H3 |
| InChIKey | BUICEXAHNYXKRW-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|