C13H19AcN3O3 — CID 23518760
actinium;2-[4-(dimethylamino)-6-nitro-1,2,3,4-tetrahydroquinolin-2-yl]ethanol (PubChem CID 23518760) has the molecular formula C13H19AcN3O3 and a molecular weight of 492.31 g/mol. Its IUPAC name is actinium;2-[4-(dimethylamino)-6-nitro-1,2,3,4-tetrahydroquinolin-2-yl]ethanol.
| Compound Name | actinium;2-[4-(dimethylamino)-6-nitro-1,2,3,4-tetrahydroquinolin-2-yl]ethanol |
|---|---|
| PubChem CID | 23518760 |
| Molecular Formula | C13H19AcN3O3 |
| Molecular Weight | 492.31 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | actinium;2-[4-(dimethylamino)-6-nitro-1,2,3,4-tetrahydroquinolin-2-yl]ethanol |
| SMILES | CN(C)C1CC(CCO)Nc2ccc([N+](=O)[O-])cc21.[Ac] |
| InChI | InChI=1S/C13H19N3O3.Ac/c1-15(2)13-7-9(5-6-17)14-12-4-3-10(16(18)19)8-11(12)13;/h3-4,8-9,13-14,17H,5-7H2,1-2H3; |
| InChIKey | UIBGUVPDXNXNGP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 78.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|