C11H13N3O3 — CID 3474586
N-(2-methyl-6-nitro-1,2,3,4-tetrahydroquinolin-4-yl)formamide (PubChem CID 3474586) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is N-(2-methyl-6-nitro-1,2,3,4-tetrahydroquinolin-4-yl)formamide.
| Compound Name | N-(2-methyl-6-nitro-1,2,3,4-tetrahydroquinolin-4-yl)formamide |
|---|---|
| PubChem CID | 3474586 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | N-(2-methyl-6-nitro-1,2,3,4-tetrahydroquinolin-4-yl)formamide |
| SMILES | CC1CC(NC=O)c2cc([N+](=O)[O-])ccc2N1 |
| InChI | InChI=1S/C11H13N3O3/c1-7-4-11(12-6-15)9-5-8(14(16)17)2-3-10(9)13-7/h2-3,5-7,11,13H,4H2,1H3,(H,12,15) |
| InChIKey | MOEVCWDTRBJQSP-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|