C12H17Cl2N3O2 — CID 76853856
N-(cyclopropylmethyl)-5-nitro-2,3-dihydro-1H-indol-3-amine;dihydrochloride (PubChem CID 76853856) has the molecular formula C12H17Cl2N3O2 and a molecular weight of 306.19 g/mol. Its IUPAC name is N-(cyclopropylmethyl)-5-nitro-2,3-dihydro-1H-indol-3-amine;dihydrochloride.
| Compound Name | N-(cyclopropylmethyl)-5-nitro-2,3-dihydro-1H-indol-3-amine;dihydrochloride |
|---|---|
| PubChem CID | 76853856 |
| Molecular Formula | C12H17Cl2N3O2 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | N-(cyclopropylmethyl)-5-nitro-2,3-dihydro-1H-indol-3-amine;dihydrochloride |
| SMILES | Cl.Cl.O=[N+]([O-])c1ccc2c(c1)C(NCC1CC1)CN2 |
| InChI | InChI=1S/C12H15N3O2.2ClH/c16-15(17)9-3-4-11-10(5-9)12(7-14-11)13-6-8-1-2-8;;/h3-5,8,12-14H,1-2,6-7H2;2*1H |
| InChIKey | NZCKYZCZNWIDSV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|