C17H24N2O2 — CID 106986424
5-nitro-3-(3,3,5-trimethylcyclohexyl)-2,3-dihydro-1H-indole (PubChem CID 106986424) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 5-nitro-3-(3,3,5-trimethylcyclohexyl)-2,3-dihydro-1H-indole.
| Compound Name | 5-nitro-3-(3,3,5-trimethylcyclohexyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 106986424 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 5-nitro-3-(3,3,5-trimethylcyclohexyl)-2,3-dihydro-1H-indole |
| SMILES | CC1CC(C2CNc3ccc([N+](=O)[O-])cc32)CC(C)(C)C1 |
| InChI | InChI=1S/C17H24N2O2/c1-11-6-12(9-17(2,3)8-11)15-10-18-16-5-4-13(19(20)21)7-14(15)16/h4-5,7,11-12,15,18H,6,8-10H2,1-3H3 |
| InChIKey | PLZUFBVWBZYQSX-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|