C17H24ClN — CID 106986426
5-chloro-3-(3,3,5-trimethylcyclohexyl)-2,3-dihydro-1H-indole (PubChem CID 106986426) has the molecular formula C17H24ClN and a molecular weight of 277.84 g/mol. Its IUPAC name is 5-chloro-3-(3,3,5-trimethylcyclohexyl)-2,3-dihydro-1H-indole.
| Compound Name | 5-chloro-3-(3,3,5-trimethylcyclohexyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 106986426 |
| Molecular Formula | C17H24ClN |
| Molecular Weight | 277.84 g/mol |
| Exact Mass | 277.16 |
| IUPAC Name | 5-chloro-3-(3,3,5-trimethylcyclohexyl)-2,3-dihydro-1H-indole |
| SMILES | CC1CC(C2CNc3ccc(Cl)cc32)CC(C)(C)C1 |
| InChI | InChI=1S/C17H24ClN/c1-11-6-12(9-17(2,3)8-11)15-10-19-16-5-4-13(18)7-14(15)16/h4-5,7,11-12,15,19H,6,8-10H2,1-3H3 |
| InChIKey | ITMDQWBBEONPEE-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.84 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |