C18H27NO — CID 106986429
7-methoxy-3-(3,3,5-trimethylcyclohexyl)-2,3-dihydro-1H-indole (PubChem CID 106986429) has the molecular formula C18H27NO and a molecular weight of 273.42 g/mol. Its IUPAC name is 7-methoxy-3-(3,3,5-trimethylcyclohexyl)-2,3-dihydro-1H-indole.
| Compound Name | 7-methoxy-3-(3,3,5-trimethylcyclohexyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 106986429 |
| Molecular Formula | C18H27NO |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.21 |
| IUPAC Name | 7-methoxy-3-(3,3,5-trimethylcyclohexyl)-2,3-dihydro-1H-indole |
| SMILES | COc1cccc2c1NCC2C1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C18H27NO/c1-12-8-13(10-18(2,3)9-12)15-11-19-17-14(15)6-5-7-16(17)20-4/h5-7,12-13,15,19H,8-11H2,1-4H3 |
| InChIKey | HYZFXAQKKLXPNX-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |