C14H19NO2 — CID 105493234
8-methoxy-4-(oxolan-3-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 105493234) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 8-methoxy-4-(oxolan-3-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 8-methoxy-4-(oxolan-3-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 105493234 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 8-methoxy-4-(oxolan-3-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | COc1cccc2c1NCCC2C1CCOC1 |
| InChI | InChI=1S/C14H19NO2/c1-16-13-4-2-3-12-11(5-7-15-14(12)13)10-6-8-17-9-10/h2-4,10-11,15H,5-9H2,1H3 |
| InChIKey | VLDOFHNBAGUULY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |