C16H17NO — CID 54763699
8-methoxy-4-phenyl-1,2,3,4-tetrahydroquinoline (PubChem CID 54763699) has the molecular formula C16H17NO and a molecular weight of 239.32 g/mol. Its IUPAC name is 8-methoxy-4-phenyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 8-methoxy-4-phenyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 54763699 |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.13 |
| IUPAC Name | 8-methoxy-4-phenyl-1,2,3,4-tetrahydroquinoline |
| SMILES | COc1cccc2c1NCCC2c1ccccc1 |
| InChI | InChI=1S/C16H17NO/c1-18-15-9-5-8-14-13(10-11-17-16(14)15)12-6-3-2-4-7-12/h2-9,13,17H,10-11H2,1H3 |
| InChIKey | CFBGAHXTUUSDPG-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |