C10H11F2NO — CID 84668692
3-(difluoromethyl)-7-methoxy-2,3-dihydro-1H-indole (PubChem CID 84668692) has the molecular formula C10H11F2NO and a molecular weight of 199.20 g/mol. Its IUPAC name is 3-(difluoromethyl)-7-methoxy-2,3-dihydro-1H-indole.
| Compound Name | 3-(difluoromethyl)-7-methoxy-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 84668692 |
| Molecular Formula | C10H11F2NO |
| Molecular Weight | 199.20 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 3-(difluoromethyl)-7-methoxy-2,3-dihydro-1H-indole |
| SMILES | COc1cccc2c1NCC2C(F)F |
| InChI | InChI=1S/C10H11F2NO/c1-14-8-4-2-3-6-7(10(11)12)5-13-9(6)8/h2-4,7,10,13H,5H2,1H3 |
| InChIKey | VJCWARBLPWROHG-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.20 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |