C19H24Cl2N2O — CID 70407541
(7R,11bR)-8-methoxy-7-phenyl-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline;dihydrochloride (PubChem CID 70407541) has the molecular formula C19H24Cl2N2O and a molecular weight of 367.32 g/mol. Its IUPAC name is (7R,11bR)-8-methoxy-7-phenyl-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline;dihydrochloride.
| Compound Name | (7R,11bR)-8-methoxy-7-phenyl-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline;dihydrochloride |
|---|---|
| PubChem CID | 70407541 |
| Molecular Formula | C19H24Cl2N2O |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 366.13 |
| IUPAC Name | (7R,11bR)-8-methoxy-7-phenyl-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline;dihydrochloride |
| SMILES | COc1cccc2c1[C@@H](c1ccccc1)CN1CCNC[C@@H]21.Cl.Cl |
| InChI | InChI=1S/C19H22N2O.2ClH/c1-22-18-9-5-8-15-17-12-20-10-11-21(17)13-16(19(15)18)14-6-3-2-4-7-14;;/h2-9,16-17,20H,10-13H2,1H3;2*1H/t16-,17+;;/m1../s1 |
| InChIKey | ZSUFDEGQFVQRAV-LWPKXAGOSA-N |
| XLogP | 3.63 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |