C19H22N2O — CID 57134658
(7R,11bS)-7-(2-methoxyphenyl)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline (PubChem CID 57134658) has the molecular formula C19H22N2O and a molecular weight of 294.40 g/mol. Its IUPAC name is (7R,11bS)-7-(2-methoxyphenyl)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline.
| Compound Name | (7R,11bS)-7-(2-methoxyphenyl)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 57134658 |
| Molecular Formula | C19H22N2O |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | (7R,11bS)-7-(2-methoxyphenyl)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline |
| SMILES | COc1ccccc1[C@@H]1CN2CCNC[C@@H]2c2ccccc21 |
| InChI | InChI=1S/C19H22N2O/c1-22-19-9-5-4-8-16(19)17-13-21-11-10-20-12-18(21)15-7-3-2-6-14(15)17/h2-9,17-18,20H,10-13H2,1H3/t17-,18-/m1/s1 |
| InChIKey | DXQAVVNXUVWGTH-QZTJIDSGSA-N |
| XLogP | 2.79 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |