C19H23N3 — CID 70407533
[2-[(7R,11bR)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-7-yl]phenyl]methanamine (PubChem CID 70407533) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is [2-[(7R,11bR)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-7-yl]phenyl]methanamine.
| Compound Name | [2-[(7R,11bR)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-7-yl]phenyl]methanamine |
|---|---|
| PubChem CID | 70407533 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | [2-[(7R,11bR)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-7-yl]phenyl]methanamine |
| SMILES | NCc1ccccc1[C@H]1CN2CCNC[C@H]2c2ccccc21 |
| InChI | InChI=1S/C19H23N3/c20-11-14-5-1-2-6-15(14)18-13-22-10-9-21-12-19(22)17-8-4-3-7-16(17)18/h1-8,18-19,21H,9-13,20H2/t18-,19+/m1/s1 |
| InChIKey | MXVIFALYGAOFBQ-MOPGFXCFSA-N |
| XLogP | 2.24 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |