C19H25Cl2N3 — CID 70408466
4-[(7S,11bR)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-7-yl]-N-methylaniline;dihydrochloride (PubChem CID 70408466) has the molecular formula C19H25Cl2N3 and a molecular weight of 366.34 g/mol. Its IUPAC name is 4-[(7S,11bR)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-7-yl]-N-methylaniline;dihydrochloride.
| Compound Name | 4-[(7S,11bR)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-7-yl]-N-methylaniline;dihydrochloride |
|---|---|
| PubChem CID | 70408466 |
| Molecular Formula | C19H25Cl2N3 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 4-[(7S,11bR)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-7-yl]-N-methylaniline;dihydrochloride |
| SMILES | CNc1ccc([C@@H]2CN3CCNC[C@H]3c3ccccc32)cc1.Cl.Cl |
| InChI | InChI=1S/C19H23N3.2ClH/c1-20-15-8-6-14(7-9-15)18-13-22-11-10-21-12-19(22)17-5-3-2-4-16(17)18;;/h2-9,18-21H,10-13H2,1H3;2*1H/t18-,19-;;/m0../s1 |
| InChIKey | IBDGOTCEKDMYPV-JYRWABTFSA-N |
| XLogP | 3.66 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |