C19H24Cl2N2 — CID 13457893
(7R,11bR)-2-methyl-7-phenyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline;dihydrochloride (PubChem CID 13457893) has the molecular formula C19H24Cl2N2 and a molecular weight of 351.32 g/mol. Its IUPAC name is (7R,11bR)-2-methyl-7-phenyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline;dihydrochloride.
| Compound Name | (7R,11bR)-2-methyl-7-phenyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline;dihydrochloride |
|---|---|
| PubChem CID | 13457893 |
| Molecular Formula | C19H24Cl2N2 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | (7R,11bR)-2-methyl-7-phenyl-1,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinoline;dihydrochloride |
| SMILES | CN1CCN2C[C@H](c3ccccc3)c3ccccc3[C@@H]2C1.Cl.Cl |
| InChI | InChI=1S/C19H22N2.2ClH/c1-20-11-12-21-13-18(15-7-3-2-4-8-15)16-9-5-6-10-17(16)19(21)14-20;;/h2-10,18-19H,11-14H2,1H3;2*1H/t18-,19+;;/m1../s1 |
| InChIKey | MXKNYRDCLVGGJD-QNCHGCKQSA-N |
| XLogP | 3.96 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |