C21H27N — CID 143013203
(6S,10bR)-6-(4-methylphenyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline;ethane (PubChem CID 143013203) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is (6S,10bR)-6-(4-methylphenyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline;ethane.
| Compound Name | (6S,10bR)-6-(4-methylphenyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline;ethane |
|---|---|
| PubChem CID | 143013203 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | (6S,10bR)-6-(4-methylphenyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline;ethane |
| SMILES | CC.Cc1ccc([C@@H]2CN3CCC[C@@H]3c3ccccc32)cc1 |
| InChI | InChI=1S/C19H21N.C2H6/c1-14-8-10-15(11-9-14)18-13-20-12-4-7-19(20)17-6-3-2-5-16(17)18;1-2/h2-3,5-6,8-11,18-19H,4,7,12-13H2,1H3;1-2H3/t18-,19+;/m0./s1 |
| InChIKey | NQGOSQROTWJRRA-GRTNUQQKSA-N |
| XLogP | 5.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |