C22H32N2 — CID 142844228
ethane;methanamine;(6S)-6-(4-methylphenyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline (PubChem CID 142844228) has the molecular formula C22H32N2 and a molecular weight of 324.51 g/mol. Its IUPAC name is ethane;methanamine;(6S)-6-(4-methylphenyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline.
| Compound Name | ethane;methanamine;(6S)-6-(4-methylphenyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 142844228 |
| Molecular Formula | C22H32N2 |
| Molecular Weight | 324.51 g/mol |
| Exact Mass | 324.26 |
| IUPAC Name | ethane;methanamine;(6S)-6-(4-methylphenyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline |
| SMILES | CC.CN.Cc1ccc([C@@H]2CN3CCCC3c3ccccc32)cc1 |
| InChI | InChI=1S/C19H21N.C2H6.CH5N/c1-14-8-10-15(11-9-14)18-13-20-12-4-7-19(20)17-6-3-2-5-16(17)18;2*1-2/h2-3,5-6,8-11,18-19H,4,7,12-13H2,1H3;1-2H3;2H2,1H3/t18-,19?;;/m0../s1 |
| InChIKey | QCGSYGCRRFWTLZ-XMWICJOTSA-N |
| XLogP | 4.88 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.51 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |