C18H18BrN — CID 70303752
(10bR)-6-(4-bromophenyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline (PubChem CID 70303752) has the molecular formula C18H18BrN and a molecular weight of 328.25 g/mol. Its IUPAC name is (10bR)-6-(4-bromophenyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline.
| Compound Name | (10bR)-6-(4-bromophenyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline |
|---|---|
| PubChem CID | 70303752 |
| Molecular Formula | C18H18BrN |
| Molecular Weight | 328.25 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | (10bR)-6-(4-bromophenyl)-1,2,3,5,6,10b-hexahydropyrrolo[2,1-a]isoquinoline |
| SMILES | Brc1ccc(C2CN3CCC[C@@H]3c3ccccc32)cc1 |
| InChI | InChI=1S/C18H18BrN/c19-14-9-7-13(8-10-14)17-12-20-11-3-6-18(20)16-5-2-1-4-15(16)17/h1-2,4-5,7-10,17-18H,3,6,11-12H2/t17?,18-/m1/s1 |
| InChIKey | ICKDQATZQOAXGJ-QRWMCTBCSA-N |
| XLogP | 4.73 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.25 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |