C19H25Cl2N3 — CID 70381041
[(7S,11bS)-7-phenyl-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-8-yl]methanamine;dihydrochloride (PubChem CID 70381041) has the molecular formula C19H25Cl2N3 and a molecular weight of 366.34 g/mol. Its IUPAC name is [(7S,11bS)-7-phenyl-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-8-yl]methanamine;dihydrochloride.
| Compound Name | [(7S,11bS)-7-phenyl-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-8-yl]methanamine;dihydrochloride |
|---|---|
| PubChem CID | 70381041 |
| Molecular Formula | C19H25Cl2N3 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | [(7S,11bS)-7-phenyl-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-8-yl]methanamine;dihydrochloride |
| SMILES | Cl.Cl.NCc1cccc2c1[C@H](c1ccccc1)CN1CCNC[C@H]21 |
| InChI | InChI=1S/C19H23N3.2ClH/c20-11-15-7-4-8-16-18-12-21-9-10-22(18)13-17(19(15)16)14-5-2-1-3-6-14;;/h1-8,17-18,21H,9-13,20H2;2*1H/t17-,18+;;/m0../s1 |
| InChIKey | LAZJBGBPOLYDNI-OAMYOWMRSA-N |
| XLogP | 3.08 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |