C19H23Cl2N3O — CID 70381856
(7S,11bS)-8-(aminomethyl)-7-phenyl-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one;dihydrochloride (PubChem CID 70381856) has the molecular formula C19H23Cl2N3O and a molecular weight of 380.32 g/mol. Its IUPAC name is (7S,11bS)-8-(aminomethyl)-7-phenyl-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one;dihydrochloride.
| Compound Name | (7S,11bS)-8-(aminomethyl)-7-phenyl-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one;dihydrochloride |
|---|---|
| PubChem CID | 70381856 |
| Molecular Formula | C19H23Cl2N3O |
| Molecular Weight | 380.32 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | (7S,11bS)-8-(aminomethyl)-7-phenyl-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one;dihydrochloride |
| SMILES | Cl.Cl.NCc1cccc2c1[C@H](c1ccccc1)CN1CCNC(=O)[C@H]21 |
| InChI | InChI=1S/C19H21N3O.2ClH/c20-11-14-7-4-8-15-17(14)16(13-5-2-1-3-6-13)12-22-10-9-21-19(23)18(15)22;;/h1-8,16,18H,9-12,20H2,(H,21,23);2*1H/t16-,18-;;/m0../s1 |
| InChIKey | KSRXUDIFRRSYJK-RYNABIAMSA-N |
| XLogP | 2.61 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.32 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |