C21H25N3O — CID 70380885
(7S,11bR)-9-[ethyl(methyl)amino]-7-phenyl-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one (PubChem CID 70380885) has the molecular formula C21H25N3O and a molecular weight of 335.45 g/mol. Its IUPAC name is (7S,11bR)-9-[ethyl(methyl)amino]-7-phenyl-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one.
| Compound Name | (7S,11bR)-9-[ethyl(methyl)amino]-7-phenyl-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one |
|---|---|
| PubChem CID | 70380885 |
| Molecular Formula | C21H25N3O |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | (7S,11bR)-9-[ethyl(methyl)amino]-7-phenyl-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one |
| SMILES | CCN(C)c1ccc2c(c1)[C@H](c1ccccc1)CN1CCNC(=O)[C@@H]21 |
| InChI | InChI=1S/C21H25N3O/c1-3-23(2)16-9-10-17-18(13-16)19(15-7-5-4-6-8-15)14-24-12-11-22-21(25)20(17)24/h4-10,13,19-20H,3,11-12,14H2,1-2H3,(H,22,25)/t19-,20+/m0/s1 |
| InChIKey | AFOFBSCKYOLNIP-VQTJNVASSA-N |
| XLogP | 2.76 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|