C18H20Cl2N2O2 — CID 70381528
(7R,11bS)-10-hydroxy-7-phenyl-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one;dihydrochloride (PubChem CID 70381528) has the molecular formula C18H20Cl2N2O2 and a molecular weight of 367.28 g/mol. Its IUPAC name is (7R,11bS)-10-hydroxy-7-phenyl-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one;dihydrochloride.
| Compound Name | (7R,11bS)-10-hydroxy-7-phenyl-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one;dihydrochloride |
|---|---|
| PubChem CID | 70381528 |
| Molecular Formula | C18H20Cl2N2O2 |
| Molecular Weight | 367.28 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | (7R,11bS)-10-hydroxy-7-phenyl-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1NCCN2C[C@H](c3ccccc3)c3ccc(O)cc3[C@@H]12 |
| InChI | InChI=1S/C18H18N2O2.2ClH/c21-13-6-7-14-15(10-13)17-18(22)19-8-9-20(17)11-16(14)12-4-2-1-3-5-12;;/h1-7,10,16-17,21H,8-9,11H2,(H,19,22);2*1H/t16-,17+;;/m1../s1 |
| InChIKey | KSXSQUYPUHZJNO-LWPKXAGOSA-N |
| XLogP | 2.85 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |