C19H22Cl2N2O2 — CID 70381516
(7S,11bS)-10-methoxy-7-phenyl-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one;dihydrochloride (PubChem CID 70381516) has the molecular formula C19H22Cl2N2O2 and a molecular weight of 381.30 g/mol. Its IUPAC name is (7S,11bS)-10-methoxy-7-phenyl-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one;dihydrochloride.
| Compound Name | (7S,11bS)-10-methoxy-7-phenyl-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one;dihydrochloride |
|---|---|
| PubChem CID | 70381516 |
| Molecular Formula | C19H22Cl2N2O2 |
| Molecular Weight | 381.30 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | (7S,11bS)-10-methoxy-7-phenyl-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one;dihydrochloride |
| SMILES | COc1ccc2c(c1)[C@H]1C(=O)NCCN1C[C@H]2c1ccccc1.Cl.Cl |
| InChI | InChI=1S/C19H20N2O2.2ClH/c1-23-14-7-8-15-16(11-14)18-19(22)20-9-10-21(18)12-17(15)13-5-3-2-4-6-13;;/h2-8,11,17-18H,9-10,12H2,1H3,(H,20,22);2*1H/t17-,18-;;/m0../s1 |
| InChIKey | GHJCNTMVYJZMIJ-MPGISEFESA-N |
| XLogP | 3.16 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.30 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |