C19H17F3N2O — CID 70381023
(7S,11bR)-7-phenyl-9-(trifluoromethyl)-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one (PubChem CID 70381023) has the molecular formula C19H17F3N2O and a molecular weight of 346.35 g/mol. Its IUPAC name is (7S,11bR)-7-phenyl-9-(trifluoromethyl)-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one.
| Compound Name | (7S,11bR)-7-phenyl-9-(trifluoromethyl)-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one |
|---|---|
| PubChem CID | 70381023 |
| Molecular Formula | C19H17F3N2O |
| Molecular Weight | 346.35 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (7S,11bR)-7-phenyl-9-(trifluoromethyl)-2,3,4,6,7,11b-hexahydropyrazino[2,1-a]isoquinolin-1-one |
| SMILES | O=C1NCCN2C[C@@H](c3ccccc3)c3cc(C(F)(F)F)ccc3[C@H]12 |
| InChI | InChI=1S/C19H17F3N2O/c20-19(21,22)13-6-7-14-15(10-13)16(12-4-2-1-3-5-12)11-24-9-8-23-18(25)17(14)24/h1-7,10,16-17H,8-9,11H2,(H,23,25)/t16-,17+/m0/s1 |
| InChIKey | WJXCKQYVJAGLHQ-DLBZAZTESA-N |
| XLogP | 3.32 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |