C12H16N2O3S — CID 110657603
3-(3-methylphenyl)-4-methylsulfonylpiperazin-2-one (PubChem CID 110657603) has the molecular formula C12H16N2O3S and a molecular weight of 268.34 g/mol. Its IUPAC name is 3-(3-methylphenyl)-4-methylsulfonylpiperazin-2-one.
| Compound Name | 3-(3-methylphenyl)-4-methylsulfonylpiperazin-2-one |
|---|---|
| PubChem CID | 110657603 |
| Molecular Formula | C12H16N2O3S |
| Molecular Weight | 268.34 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | 3-(3-methylphenyl)-4-methylsulfonylpiperazin-2-one |
| SMILES | Cc1cccc(C2C(=O)NCCN2S(C)(=O)=O)c1 |
| InChI | InChI=1S/C12H16N2O3S/c1-9-4-3-5-10(8-9)11-12(15)13-6-7-14(11)18(2,16)17/h3-5,8,11H,6-7H2,1-2H3,(H,13,15) |
| InChIKey | MCUDIMTUJGAINZ-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.34 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |