C17H18N2O3S — CID 154743058
5-[[2-(3-methylphenyl)-3-oxopiperazin-1-yl]methyl]thiophene-2-carboxylic acid (PubChem CID 154743058) has the molecular formula C17H18N2O3S and a molecular weight of 330.41 g/mol. Its IUPAC name is 5-[[2-(3-methylphenyl)-3-oxopiperazin-1-yl]methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[2-(3-methylphenyl)-3-oxopiperazin-1-yl]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 154743058 |
| Molecular Formula | C17H18N2O3S |
| Molecular Weight | 330.41 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 5-[[2-(3-methylphenyl)-3-oxopiperazin-1-yl]methyl]thiophene-2-carboxylic acid |
| SMILES | Cc1cccc(C2C(=O)NCCN2Cc2ccc(C(=O)O)s2)c1 |
| InChI | InChI=1S/C17H18N2O3S/c1-11-3-2-4-12(9-11)15-16(20)18-7-8-19(15)10-13-5-6-14(23-13)17(21)22/h2-6,9,15H,7-8,10H2,1H3,(H,18,20)(H,21,22) |
| InChIKey | RMXGNGVQMNAFRB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |