C16H21N3O3 — CID 110657586
3-(3-methylphenyl)-4-(morpholine-4-carbonyl)piperazin-2-one (PubChem CID 110657586) has the molecular formula C16H21N3O3 and a molecular weight of 303.36 g/mol. Its IUPAC name is 3-(3-methylphenyl)-4-(morpholine-4-carbonyl)piperazin-2-one.
| Compound Name | 3-(3-methylphenyl)-4-(morpholine-4-carbonyl)piperazin-2-one |
|---|---|
| PubChem CID | 110657586 |
| Molecular Formula | C16H21N3O3 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | 3-(3-methylphenyl)-4-(morpholine-4-carbonyl)piperazin-2-one |
| SMILES | Cc1cccc(C2C(=O)NCCN2C(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C16H21N3O3/c1-12-3-2-4-13(11-12)14-15(20)17-5-6-19(14)16(21)18-7-9-22-10-8-18/h2-4,11,14H,5-10H2,1H3,(H,17,20) |
| InChIKey | YFJOWVSLSJAKKI-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |