C11H13ClN2O3S — CID 110656884
3-(3-chlorophenyl)-4-methylsulfonylpiperazin-2-one (PubChem CID 110656884) has the molecular formula C11H13ClN2O3S and a molecular weight of 288.76 g/mol. Its IUPAC name is 3-(3-chlorophenyl)-4-methylsulfonylpiperazin-2-one.
| Compound Name | 3-(3-chlorophenyl)-4-methylsulfonylpiperazin-2-one |
|---|---|
| PubChem CID | 110656884 |
| Molecular Formula | C11H13ClN2O3S |
| Molecular Weight | 288.76 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 3-(3-chlorophenyl)-4-methylsulfonylpiperazin-2-one |
| SMILES | CS(=O)(=O)N1CCNC(=O)C1c1cccc(Cl)c1 |
| InChI | InChI=1S/C11H13ClN2O3S/c1-18(16,17)14-6-5-13-11(15)10(14)8-3-2-4-9(12)7-8/h2-4,7,10H,5-6H2,1H3,(H,13,15) |
| InChIKey | XWHGHRJOFKJABF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.76 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |