C19H21Cl2F3N2 — CID 21292107
7-phenyl-9-(trifluoromethyl)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline;dihydrochloride (PubChem CID 21292107) has the molecular formula C19H21Cl2F3N2 and a molecular weight of 405.29 g/mol. Its IUPAC name is 7-phenyl-9-(trifluoromethyl)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline;dihydrochloride.
| Compound Name | 7-phenyl-9-(trifluoromethyl)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline;dihydrochloride |
|---|---|
| PubChem CID | 21292107 |
| Molecular Formula | C19H21Cl2F3N2 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | 7-phenyl-9-(trifluoromethyl)-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinoline;dihydrochloride |
| SMILES | Cl.Cl.FC(F)(F)c1ccc2c(c1)C(c1ccccc1)CN1CCNCC21 |
| InChI | InChI=1S/C19H19F3N2.2ClH/c20-19(21,22)14-6-7-15-16(10-14)17(13-4-2-1-3-5-13)12-24-9-8-23-11-18(15)24;;/h1-7,10,17-18,23H,8-9,11-12H2;2*1H |
| InChIKey | FKCNMTKQVXONAT-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |