C18H23Cl2N3 — CID 70380809
(7S,11bS)-7-phenyl-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-11-amine;dihydrochloride (PubChem CID 70380809) has the molecular formula C18H23Cl2N3 and a molecular weight of 352.31 g/mol. Its IUPAC name is (7S,11bS)-7-phenyl-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-11-amine;dihydrochloride.
| Compound Name | (7S,11bS)-7-phenyl-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-11-amine;dihydrochloride |
|---|---|
| PubChem CID | 70380809 |
| Molecular Formula | C18H23Cl2N3 |
| Molecular Weight | 352.31 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (7S,11bS)-7-phenyl-2,3,4,6,7,11b-hexahydro-1H-pyrazino[2,1-a]isoquinolin-11-amine;dihydrochloride |
| SMILES | Cl.Cl.Nc1cccc2c1[C@H]1CNCCN1C[C@H]2c1ccccc1 |
| InChI | InChI=1S/C18H21N3.2ClH/c19-16-8-4-7-14-15(13-5-2-1-3-6-13)12-21-10-9-20-11-17(21)18(14)16;;/h1-8,15,17,20H,9-12,19H2;2*1H/t15-,17+;;/m0../s1 |
| InChIKey | SWDNBMWVNRXZKH-WUGUAYAESA-N |
| XLogP | 3.20 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|