C18H22N2O — CID 53237372
2-(2-methoxyphenyl)-1-phenyl-1,4-diazepane (PubChem CID 53237372) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-(2-methoxyphenyl)-1-phenyl-1,4-diazepane.
| Compound Name | 2-(2-methoxyphenyl)-1-phenyl-1,4-diazepane |
|---|---|
| PubChem CID | 53237372 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-(2-methoxyphenyl)-1-phenyl-1,4-diazepane |
| SMILES | COc1ccccc1C1CNCCCN1c1ccccc1 |
| InChI | InChI=1S/C18H22N2O/c1-21-18-11-6-5-10-16(18)17-14-19-12-7-13-20(17)15-8-3-2-4-9-15/h2-6,8-11,17,19H,7,12-14H2,1H3 |
| InChIKey | FHTBQFYHCGTIGM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |